CymitQuimica logo

CAS 10295-49-5

:

2-hydroxy-N-(4-methoxyphenyl)-2-phenylacetamide

Description:
2-Hydroxy-N-(4-methoxyphenyl)-2-phenylacetamide, with the CAS number 10295-49-5, is an organic compound characterized by its amide functional group and the presence of both hydroxy and methoxy substituents. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its moderate polarity due to the presence of the hydroxy group. The methoxy group enhances its lipophilicity, potentially influencing its biological activity and interactions. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential hydrogen bonding capabilities due to the hydroxy group, which can affect its solubility and reactivity. Additionally, the presence of aromatic rings contributes to its stability and may influence its electronic properties. Overall, 2-hydroxy-N-(4-methoxyphenyl)-2-phenylacetamide is a compound of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C15H15NO3
InChI:InChI=1/C15H15NO3/c1-19-13-9-7-12(8-10-13)16-15(18)14(17)11-5-3-2-4-6-11/h2-10,14,17H,1H3,(H,16,18)
SMILES:COc1ccc(cc1)NC(=O)C(c1ccccc1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.