CAS 10295-90-6
:3-Hydroxy-4-(N,N-dimethylamino)tetrahydrofuran
Description:
3-Hydroxy-4-(N,N-dimethylamino)tetrahydrofuran, with the CAS number 10295-90-6, is an organic compound characterized by its tetrahydrofuran ring structure, which is a five-membered cyclic ether. The presence of a hydroxyl group (-OH) at the 3-position contributes to its polarity and potential for hydrogen bonding, enhancing its solubility in polar solvents. The N,N-dimethylamino group at the 4-position introduces basicity and can participate in various chemical reactions, making the compound versatile in synthetic applications. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological systems. Additionally, its stability and reactivity can be influenced by the presence of the hydroxyl and dimethylamino groups, making it a candidate for further research in medicinal chemistry and organic synthesis. Overall, 3-Hydroxy-4-(N,N-dimethylamino)tetrahydrofuran is notable for its unique functional groups and potential applications in various chemical and pharmaceutical contexts.
Formula:C6H13NO2
InChI:InChI=1/C6H13NO2/c1-7(2)5-3-9-4-6(5)8/h5-6,8H,3-4H2,1-2H3/t5-,6-/m0/s1
SMILES:CN(C)[C@H]1COC[C@@H]1O
Synonyms:- (3R,4S)-4-(dimethylamino)tetrahydrofuran-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
