CAS 102955-75-9
:N-[5-(4-aminophenoxy)pentyl]-N-phenylbenzamide
Description:
N-[5-(4-aminophenoxy)pentyl]-N-phenylbenzamide, with the CAS number 102955-75-9, is a chemical compound characterized by its amide functional group, which is formed between a carboxylic acid and an amine. This compound features a phenyl group attached to the nitrogen atom of the amide, along with a pentyl chain that is substituted with a 4-aminophenoxy group. The presence of the amino group suggests potential for hydrogen bonding and reactivity, which may influence its solubility and interaction with biological systems. The compound's structure indicates it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand or a pharmacophore in drug design. Its molecular architecture suggests it could participate in various chemical reactions, including acylation and nucleophilic substitutions. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it as a candidate for further research in chemical and pharmaceutical applications.
Formula:C24H26N2O2
InChI:InChI=1/C24H26N2O2/c25-21-14-16-23(17-15-21)28-19-9-3-8-18-26(22-12-6-2-7-13-22)24(27)20-10-4-1-5-11-20/h1-2,4-7,10-17H,3,8-9,18-19,25H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzanilide, N-(5-(p-aminophenoxy)pentyl)-
CAS:<p>Benzanilide, N-(5-(p-aminophenoxy)pentyl)- is a bioactive chemical.</p>Formula:C24H26N2O2Color and Shape:SolidMolecular weight:374.48
