CAS 10296-76-1
:2,3-Dihydroxy-1-propanesulfonic acid
Description:
2,3-Dihydroxy-1-propanesulfonic acid, also known as DHPS, is an organic compound characterized by the presence of both hydroxyl (-OH) and sulfonic acid (-SO3H) functional groups. This compound is a colorless to pale yellow liquid that is soluble in water, making it useful in various aqueous applications. Its molecular structure features a three-carbon chain with two hydroxyl groups located on the second and third carbons, contributing to its hydrophilicity and reactivity. DHPS is often utilized in biochemical and pharmaceutical research, particularly as a buffering agent or in the synthesis of other chemical compounds. The sulfonic acid group imparts strong acidic properties, allowing it to participate in various chemical reactions, including esterification and sulfonation. Additionally, its ability to form hydrogen bonds due to the hydroxyl groups enhances its interactions with other molecules, making it valuable in formulations requiring solubility and stability. Overall, 2,3-Dihydroxy-1-propanesulfonic acid is a versatile compound with significant applications in both research and industry.
Formula:C3H8O5S
InChI:InChI=1S/C3H8O5S/c4-1-3(5)2-9(6,7)8/h3-5H,1-2H2,(H,6,7,8)
InChI key:InChIKey=YPFUJZAAZJXMIP-UHFFFAOYSA-N
SMILES:C(S(=O)(=O)O)C(CO)O
Synonyms:- 1,2-Dihydroxy-3-propanesulfonic acid
- 1-Propanesulfonic acid, 2,3-dihydroxy-
- 2,3-Dihydroxy-1-propanesulfonic acid
- 2,3-Dihydroxypropane-1-Sulfonic Acid
- Sulfopropanediol
- 2,3-Dihydroxypropanesulphonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,3-Dihydroxypropane-1-sulfonic acid
CAS:2,3-Dihydroxypropane-1-sulfonic acid is a hydrophilic monomer that is used to produce polyesters. It has an allyl group that reacts with triphosgene to form a conjugate acid. This acid reacts with the hydroxyl groups on the polyester to create ester bonds. 2,3-Dihydroxypropane-1-sulfonic acid is copolymerized with other hydrophilic monomers such as ethylene glycol to produce a water resistant coating for metal surfaces or plastics. 2,3-Dihydroxypropane-1-sulfonic acid also has emulsifying properties and can be used in conjunction with sodium salts to create emulsions in paints and coatings. The hydrogen elimination reaction of 2,3-dihydroxypropane-1-sulfonic acid produces cyclic sulfamic acid and its derivative, which are used as radiationFormula:C3H8O5SPurity:Min. 95%Molecular weight:156.16 g/mol
