CAS 1029649-48-6
:1,1-Dimethylethyl N-(2-isocyanophenyl)carbamate
Description:
1,1-Dimethylethyl N-(2-isocyanophenyl)carbamate, identified by its CAS number 1029649-48-6, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is known for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to its ability to interact with biological systems. The presence of the isocyanophenyl group suggests that it may have specific reactivity patterns, particularly in relation to nucleophiles. Additionally, the dimethyl group contributes to its steric hindrance, which can influence its biological activity and stability. Safety data sheets would indicate that it may pose certain hazards, necessitating proper handling and storage protocols. Overall, its unique structure and functional groups make it a compound of interest in both research and practical applications within the field of chemistry.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-12(2,3)16-11(15)14-10-8-6-5-7-9(10)13-4/h5-8H,1-3H3,(H,14,15)
InChI key:InChIKey=MVRGMAILZSXBEN-UHFFFAOYSA-N
SMILES:N(C(OC(C)(C)C)=O)C1=C([N+]#[C-])C=CC=C1
Synonyms:- 1,1-Dimethylethyl N-(2-isocyanophenyl)carbamate
- 2-(N-Boc-amino)-phenyl-isocyanide
- Carbamic acid, N-(2-isocyanophenyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.