CAS 1029654-20-3
:B-(2-Fluoro-4-phenyl-3-pyridinyl)boronic acid
Description:
B-(2-Fluoro-4-phenyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a fluorine atom and a phenyl group, contributing to its unique electronic and steric properties. The presence of the boronic acid moiety allows it to participate in various chemical reactions, including Suzuki coupling, which is widely used in organic synthesis for forming carbon-carbon bonds. Additionally, the fluorine substitution can enhance the compound's lipophilicity and influence its biological activity, making it of interest in medicinal chemistry. Its solubility and stability in different solvents can vary, which is important for its application in synthetic pathways. Overall, B-(2-Fluoro-4-phenyl-3-pyridinyl)boronic acid is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C11H9BFNO2
InChI:InChI=1S/C11H9BFNO2/c13-11-10(12(15)16)9(6-7-14-11)8-4-2-1-3-5-8/h1-7,15-16H
InChI key:InChIKey=GHEDZEBCBHHDNA-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(=CC=NC1F)C2=CC=CC=C2
Synonyms:- B-(2-Fluoro-4-phenyl-3-pyridinyl)boronic acid
- Boronic acid, B-(2-fluoro-4-phenyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
