CAS 1029654-28-1
:B-(2-Chloro-6-phenyl-3-pyridinyl)boronic acid
Description:
B-(2-Chloro-6-phenyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a phenyl group and a chlorine atom, contributing to its unique reactivity and potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the chlorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity. The compound's solubility and stability in various solvents can vary, which is important for its application in laboratory settings. Overall, B-(2-Chloro-6-phenyl-3-pyridinyl)boronic acid is a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C11H9BClNO2
InChI:InChI=1S/C11H9BClNO2/c13-11-9(12(15)16)6-7-10(14-11)8-4-2-1-3-5-8/h1-7,15-16H
InChI key:InChIKey=XCVHXMPPXRZZIB-UHFFFAOYSA-N
SMILES:ClC1=NC(=CC=C1B(O)O)C2=CC=CC=C2
Synonyms:- B-(2-Chloro-6-phenyl-3-pyridinyl)boronic acid
- Boronic acid, B-(2-chloro-6-phenyl-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
