CAS 1029691-07-3

2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-1,2,3,4-tetrahydrocyclopent[b]indole-7-carbonitrile

Description:

The chemical substance known as 2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-1,2,3,4-tetrahydrocyclopent[b]indole-7-carbonitrile, with the CAS number 1029691-07-3, is a complex organic compound characterized by its unique structural features. It contains multiple fused ring systems, including an isoindole and a cyclopent[b]indole framework, which contribute to its potential biological activity. The presence of a carbonitrile group indicates that it may exhibit specific reactivity and interactions, particularly in biological systems. The dioxo functional groups suggest potential for hydrogen bonding and reactivity, which could influence its solubility and stability. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. However, detailed studies on its physical and chemical properties, such as solubility, melting point, and spectral characteristics, would be necessary to fully understand its behavior and applications in various fields, including drug development and materials science.

Formula: C₂₀H₁₃N₃O₂

InChI: InChI=1S/C20H13N3O2/c21-10-11-5-6-17-15(7-11)16-8-12(9-18(16)22-17)23-19(24)13-3-1-2-4-14(13)20(23)25/h1-7,12,22H,8-9H2

InChI key: InChIKey=NBNLXVDIURVLAP-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C2C3=C(CC(C3)N4C(=O)C=5C(C4=O)=CC=CC5)NC2=CC1

Synonyms:

• 2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)-1,2,3,4-tetrahydrocyclopent[b]indole-7-carbonitrile
• Cyclopent[b]indole-7-carbonitrile, 2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-1,2,3,4-tetrahydro-
• 2-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile