CAS 1029691-09-5

2-amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile

Description:

2-amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile is a chemical compound characterized by its complex bicyclic structure, which includes a cyclopentane ring fused to an indole moiety. This compound features an amino group and a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the carbonitrile group suggests that it may participate in nucleophilic reactions, while the amino group can engage in hydrogen bonding and may influence solubility and interaction with biological targets. The tetrahydro configuration indicates that the compound is saturated, which can affect its stability and reactivity compared to unsaturated analogs. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for developing pharmaceuticals or studying biological pathways. Its specific properties, such as melting point, solubility, and spectral characteristics, would require experimental determination or detailed literature references for precise values.

Formula: C₁₂H₁₁N₃

InChI: InChI=1S/C12H11N3/c13-6-7-1-2-11-9(3-7)10-4-8(14)5-12(10)15-11/h1-3,8,15H,4-5,14H2

SMILES: c1cc2c(cc1C#N)c1CC(Cc1[nH]2)N

Synonyms:

• Cyclopent[b]indole-7-carbonitrile, 2-amino-1,2,3,4-tetrahydro-

2-Amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile

CAS: 1029691-09-5

Formula: C₁₂H₁₁N₃

Molecular weight: 197.2358

Ref: IN-DA007IDW

2-Amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile

CAS: 1029691-09-5

2-Amino-1,2,3,4-tetrahydrocyclopenta[b]indole-7-carbonitrile

Purity: ≥95%

Molecular weight: 197.24g/mol

Ref: 54-OR350401