CymitQuimica logo

CAS 1029714-85-9

:

α-Chloro-6-quinolinepropanal

Description:
α-Chloro-6-quinolinepropanal is a chemical compound characterized by its unique structure, which combines a quinoline moiety with an aldehyde functional group and a chloro substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its aromatic nature. The presence of the chloro group enhances its reactivity, making it a potential intermediate in various organic synthesis reactions. The aldehyde functional group allows for further derivatization, enabling the formation of a variety of other chemical entities. Additionally, compounds like α-Chloro-6-quinolinepropanal may exhibit biological activity, which can be of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental analysis. As with many chemical substances, safety precautions should be observed when handling this compound due to potential toxicity and reactivity.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c13-11(8-15)7-9-3-4-12-10(6-9)2-1-5-14-12/h1-6,8,11H,7H2
InChI key:InChIKey=KRKHRJAAILLRNE-UHFFFAOYSA-N
SMILES:C(C(C=O)Cl)C1=CC2=C(C=C1)N=CC=C2
Synonyms:
  • α-Chloro-6-quinolinepropanal
  • 6-Quinolinepropanal, α-chloro-
  • 2-Chloro-3-(quinolin-6-yl)propanal
  • Capmatinib Impurity 6
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.