CAS 10298-11-0

1-(2-Chloroethyl)-3-methylpiperidine

Description:

1-(2-Chloroethyl)-3-methylpiperidine, with the CAS number 10298-11-0, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a chloroethyl group attached to the nitrogen atom of the piperidine, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methyl group at the 3-position of the piperidine ring influences its steric and electronic properties, which can affect its biological activity and interaction with various receptors. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential volatility, depending on the specific conditions. Additionally, due to the presence of the chloro group, it may participate in nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₈H₁₆ClN

InChI: InChI=1S/C8H16ClN/c1-8-3-2-5-10(7-8)6-4-9/h8H,2-7H2,1H3

InChI key: InChIKey=ZMTCYZCFHILUTI-UHFFFAOYSA-N

SMILES: C(CCl)N1CC(C)CCC1

Synonyms:

• 1-(2-Chloroethyl)-3-methylpiperidine
• 3-Pipecoline, 1-(2-chloroethyl)-
• Piperidine, 1-(2-chloroethyl)-3-methyl-
• N-(2-Chloroethyl)-3-methylpiperidine