CAS 102989-83-3
:1-Phenyl-3-methyl-6-trifluoromethyl-pyrazolo(3,4-d)pyrimidine-4(5H)thione
Description:
1-Phenyl-3-methyl-6-trifluoromethyl-pyrazolo(3,4-d)pyrimidine-4(5H)thione, with CAS number 102989-83-3, is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a phenyl group and a trifluoromethyl group, contributing to its unique chemical properties and potential biological activity. The presence of the thione functional group indicates that it may exhibit thioketone-like behavior, which can influence its reactivity and interactions with other molecules. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. Additionally, the pyrazolo-pyrimidine framework is often associated with various pharmacological activities, including anti-inflammatory and anticancer properties. The compound's solubility, stability, and reactivity can be influenced by its substituents, making it a candidate for further research in drug development and synthetic applications. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in organic chemistry.
Formula:C13H9F3N4S
InChI:InChI=1/C13H9F3N4S/c1-7-9-10(17-12(13(14,15)16)18-11(9)21)20(19-7)8-5-3-2-4-6-8/h2-6,19H,1H3
SMILES:Cc1c2c(nc(C(F)(F)F)nc2=S)n(c2ccccc2)[nH]1
Synonyms:- F-Ppt
- 3-methyl-1-phenyl-6-(trifluoromethyl)-1,2-dihydro-4H-pyrazolo[3,4-d]pyrimidine-4-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.