CymitQuimica logo

CAS 10299-74-8

:

3-Ethyl-1H-pyrrolo[2,3-b]pyridine

Description:
3-Ethyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular formula that reflects its structure, containing carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the ethyl group at the 3-position of the pyrrole ring can influence its reactivity and solubility, affecting how it interacts with biological systems. Additionally, the compound may exhibit fluorescence, which can be useful in various analytical applications. Its synthesis often involves multi-step organic reactions, and it may be utilized in the development of pharmaceuticals or as a building block in organic synthesis. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, making it a subject of study in materials science and organic electronics. Safety and handling precautions should be observed due to its potential biological effects.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c1-2-7-6-11-9-8(7)4-3-5-10-9/h3-6H,2H2,1H3,(H,10,11)
InChI key:InChIKey=MVVXQWGFSJITIZ-UHFFFAOYSA-N
SMILES:C(C)C=1C=2C(NC1)=NC=CC2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 3-ethyl-
  • 3-Ethyl-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.