
CAS 1029989-17-0
:1H-Isoindole-1,3(2H)-dione, 2-[2-[2-[(4-methoxyphenyl)amino]-4-thiazolyl]ethyl]-, hydrobromide (1:1)
Description:
1H-Isoindole-1,3(2H)-dione, 2-[2-[2-[(4-methoxyphenyl)amino]-4-thiazolyl]ethyl]-, hydrobromide (1:1), with CAS number 1029989-17-0, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole core and a thiazole moiety. This compound typically exhibits properties such as solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the methoxyphenyl and thiazolyl groups suggests that it may interact with various biological targets, potentially influencing its pharmacological profile. The hydrobromide salt form indicates enhanced stability and solubility, which is often advantageous for drug formulation. Additionally, compounds of this nature may exhibit properties such as fluorescence or specific reactivity due to their unique structural features. Overall, this compound's characteristics make it a candidate for further investigation in drug development and related fields.
Formula:C20H17N3O3S·BrH
InChI:InChI=1S/C20H17N3O3S.BrH/c1-26-15-8-6-13(7-9-15)21-20-22-14(12-27-20)10-11-23-18(24)16-4-2-3-5-17(16)19(23)25;/h2-9,12H,10-11H2,1H3,(H,21,22);1H
InChI key:InChIKey=HODNBHOHEUVRMP-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC=3N=C(NC4=CC=C(OC)C=C4)SC3)=CC=CC2.Br
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-[2-[2-[(4-methoxyphenyl)amino]-4-thiazolyl]ethyl]-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.