CAS 103-02-6
:2-Propanone, 2-phenylhydrazone
Description:
2-Propanone, 2-phenylhydrazone, also known as acetone phenylhydrazone, is an organic compound characterized by its hydrazone functional group. It is formed through the condensation reaction of acetone and phenylhydrazine. This compound typically appears as a crystalline solid and is known for its moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water. The presence of the hydrazone linkage imparts specific reactivity, making it useful in various organic synthesis applications, including the formation of other derivatives and as a reagent in analytical chemistry. 2-Propanone, 2-phenylhydrazone can exhibit properties such as melting point and boiling point that are influenced by its molecular structure and intermolecular interactions. Additionally, it may show some degree of stability under standard conditions but can be sensitive to heat and light, which may lead to decomposition. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C9H12N2
InChI:InChI=1S/C9H12N2/c1-8(2)10-11-9-6-4-3-5-7-9/h3-7,11H,1-2H3
InChI key:InChIKey=JQLKSEQEILIJEG-UHFFFAOYSA-N
SMILES:N(N=C(C)C)C1=CC=CC=C1
Synonyms:- 2-Propanone, 2-phenylhydrazone
- 2-Propanone, 2-phenylhydrazone
- 1-phenyl-2-(propan-2-ylidene)hydrazine
- Acetone phenylhydrazone
- 1-Phenyl-2-(propan-2-ylidene)hydrazine
- NSC 65251
- Acetone, phenylhydrazone
- NSC 65251
- 2-Propanone, phenylhydrazone
- AI3-15277
- 2-Propanone, phenylhydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Acetone phenylhydrazone
CAS:Acetone phenylhydrazone is a biochemical.Formula:C9H12N2Color and Shape:SolidMolecular weight:148.21



