![2-[(Phenylmethyl)thio]acetic acid](https://static.cymitquimica.com/cas-image/28871-2-phenylmethyl-thio-acetic-acid.png)
CAS 103-46-8: 2-[(Phenylmethyl)thio]acetic acid
Description:2-[(Phenylmethyl)thio]acetic acid, also known as thiophenacetic acid, is an organic compound characterized by the presence of both a thiol and a carboxylic acid functional group. Its molecular structure features a phenylmethyl (benzyl) group attached to a sulfur atom, which is further connected to an acetic acid moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic phenyl group. The presence of the thiol group imparts unique reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and redox reactions. 2-[(Phenylmethyl)thio]acetic acid is of interest in medicinal chemistry and organic synthesis, where it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions, making it essential to consult specific literature for detailed information in practical applications.
Formula:C9H10O2S
InChI:InChI=1S/C9H10O2S/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)
InChI key:InChIKey=AWLVTQRRKPBQEQ-UHFFFAOYSA-N
SMILES:O=C(O)CSCC=1C=CC=CC1
- Synonyms:
- (Benzylsulfanyl)Acetate
- (Benzylsulfanyl)Acetic Acid
- (Benzylthio)acetic acid
- 2,3-Dihydro-1,4-Benzodioxine-6-Carbaldehyde
- 2-(Benzylsulfanyl)acetic acid
- 2-(Benzylthio)acetic acid
- 2-Benzylsulfanylacetic acid
- 2-[(Phenylmethyl)thio]acetic acid
- Acetic acid, (benzylthio)-
- Acetic acid, 2-[(phenylmethyl)thio]-
- See more synonyms
- Acetic acid, [(phenylmethyl)thio]-
- Benzylmercaptoacetic acid
- Carboxymethyl benzyl sulfide
- NSC 26553
- S-Benzylmercaptoacetic acid
- S-Benzylthioglycolic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-(Benzylthio)acetic acid REF: IN-DA003BZLCAS: 103-46-8 | 97% | 33.00 €~603.00 € | Tue 15 Apr 25 |
 | Carboxymethyl benzyl sulfide REF: 54-OR74603CAS: 103-46-8 | 0.95 | 103.00 €~148.00 € | Wed 16 Apr 25 |
 | 2-(BENZYLTHIO)ACETIC ACID REF: 10-F301888CAS: 103-46-8 | 97.0% | 42.00 €~80.00 € | Mon 21 Apr 25 |
 | (Benzylthio)acetic acid REF: 3D-FB119413CAS: 103-46-8 | Min. 95% | - - - | Discontinued product |
2-(Benzylthio)acetic acid
Ref: IN-DA003BZL
| 1g | 51.00 € | ||
| 5g | 82.00 € | ||
| 10g | 122.00 € | ||
| 100mg | 33.00 € | ||
| 250mg | 40.00 € |
Ref: 54-OR74603
| 1g | 103.00 € | ||
| 5g | 111.00 € | ||
| 10g | 148.00 € |
2-(BENZYLTHIO)ACETIC ACID
Ref: 10-F301888
| 1g | 42.00 € | ||
| 5g | 49.00 € | ||
| 10g | 80.00 € |
(Benzylthio)acetic acid
Ref: 3D-FB119413
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
