CAS 103-82-2
:Phenylacetic acid
Description:
Phenylacetic acid is an aromatic carboxylic acid characterized by its molecular formula C8H8O2. It features a phenyl group (a benzene ring) attached to an acetic acid moiety, which contributes to its unique properties. This compound typically appears as a colorless to pale yellow liquid with a sweet, floral odor. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. Phenylacetic acid is known for its role in the synthesis of various pharmaceuticals and fragrances, as well as serving as a building block in organic chemistry. Its melting point is around room temperature, and it has a boiling point that indicates it can be easily vaporized. Additionally, it exhibits mild acidity, making it a weak acid in aqueous solutions. Due to its structural features, phenylacetic acid can participate in various chemical reactions, including esterification and amidation, further expanding its utility in chemical synthesis and industrial applications.
Formula:C8H8O2
InChI:InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10)
InChI key:InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=CC=C1
Synonyms:- 2-Phenylacetic acid
- Acetic acid, phenyl-
- Acide phenylacetique
- Acido Fenilacetico
- Benzeneacetic acid
- Nsc 125718
- PAA
- Phenyl-Acetic Acid
- Phenylessigsaeure
- Phenylessigsaure
- Phenylethanoic acid
- Phenysan
- α-Toluic acid
- ω-Phenylacetic acid
- Phenylacetic acid
- alpha-Tolylic acid
- Phenoxacetic acid
- calcium bis(phenylacetate)
- ammonium phenylacetate
- alpha-Toluic acid
- phenylacetate
- sodium phenylacetate
- a-Tolylic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Phenylacetic acid
CAS:Controlled ProductPhenylacetic acidFormula:C8H8O2Color and Shape:Off-WhiteMolecular weight:136.1479TROPICAMIDE IMPURITY D CRS - * DRUG PRECURSOR (PHENYLACETIC ACID)
CAS:Controlled ProductTROPICAMIDE IMPURITY D CRS - * DRUG PRECURSOR (PHENYLACETIC ACID)Formula:C8H8O2Color and Shape:Powder.Molecular weight:136.1479Benzathine Benzylpenicillin EP Impurity B
CAS:Controlled ProductFormula:C8H8O2Molecular weight:136.15Tropicamide Related Compound D (2-Phenylacetic acid)
CAS:Controlled ProductPhenylacetic acid (alpha-toluic acid) and its saltsFormula:C8H8O2Color and Shape:Beige PowderMolecular weight:136.05243Phenylacetic acid
CAS:Controlled ProductPlease enquire for more information about Phenylacetic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C8H8O2Purity:Min. 95%Color and Shape:PowderMolecular weight:136.15 g/mol







