
CAS 103-98-0
:N-Lauroyl-4-aminophenol
Description:
N-Lauroyl-4-aminophenol, with the CAS number 103-98-0, is an organic compound characterized by its structure, which includes a lauroyl group (derived from lauric acid) attached to a 4-aminophenol moiety. This compound typically appears as a solid or powder and is known for its surfactant properties, making it useful in various applications, including cosmetics and personal care products. It exhibits both hydrophilic and lipophilic characteristics due to the presence of the amine and phenolic groups, which allows it to interact with both water and oils. N-Lauroyl-4-aminophenol can also act as an antioxidant and may have potential applications in pharmaceuticals and as a dye intermediate. Its solubility is influenced by the pH of the environment, and it is generally stable under normal conditions. However, like many organic compounds, it should be handled with care, considering potential health and environmental impacts. Proper safety measures should be observed when working with this substance.
Formula:C18H29NO2
InChI:InChI=1S/C18H29NO2/c1-2-3-4-5-6-7-8-9-10-11-18(21)19-16-12-14-17(20)15-13-16/h12-15,20H,2-11H2,1H3,(H,19,21)
InChI key:InChIKey=JVKWTDRHWOSRFT-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCCCC)=O)C1=CC=C(O)C=C1
Synonyms:- 4′-Hydroxydodecananilide
- Dodecananilide, 4′-hydroxy-
- N-Lauroyl-p-aminophenol
- N-(4-Hydroxyphenyl)dodecanamide
- Dodecanamide, N-(4-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.