CAS 10300-20-6

5-O-benzoyl-3-O-methyl-1,2-O-(1-methylethylidene)pentofuranose

Description:

5-O-benzoyl-3-O-methyl-1,2-O-(1-methylethylidene)pentofuranose is a chemical compound that belongs to the class of furanoses, which are five-membered cyclic sugars. This compound features a benzoyl group, which is a common aromatic acyl group, contributing to its potential reactivity and stability. The presence of the methoxy group (O-methyl) indicates that it has a methyl ether functionality, which can influence its solubility and reactivity in various chemical environments. The 1,2-O-(1-methylethylidene) moiety suggests that the compound has a specific stereochemistry, which can affect its biological activity and interaction with other molecules. This compound may be of interest in organic synthesis and medicinal chemistry due to its structural features, which could be relevant for the development of glycosides or other derivatives. Its CAS number, 10300-20-6, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₆H₂₀O₆

InChI: InChI=1/C16H20O6/c1-16(2)21-13-12(18-3)11(20-15(13)22-16)9-19-14(17)10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3

SMILES: CC1(C)OC2C(C(COC(=O)c3ccccc3)OC2O1)OC

5-O-Benzoyl-1,2-di-O-isopropylidene-3-O-methyl-a-D-ribofuranose

CAS: 10300-20-6

5-O-Benzoyl-1,2-di-O-isopropylidene-3-O-methyl-aDribofuranose is a carbohydrate that is used in the synthesis of oligosaccharides and polysaccharides. It is an important component of many natural products, including glycoproteins and glycosphingolipids. 5-O-Benzoyl-1,2-di-(O)isopropylidene-(3) O -methyla Dribofuranose is a synthetic carbohydrate that can be custom synthesized to meet your desired specifications. This product has been modified by methylation and glycosylation to increase the purity and quality of this product.

Purity: Min. 95%

Ref: 3D-MB162820