CAS 10300-27-3: 3′-O-Methylguanosine
Description:3′-O-Methylguanosine is a modified nucleoside that plays a significant role in various biological processes, particularly in RNA metabolism. It consists of a guanine base attached to a ribose sugar, with a methyl group added to the 3′ hydroxyl position of the ribose. This modification can influence the stability and function of RNA molecules, affecting processes such as splicing, translation, and the overall regulation of gene expression. 3′-O-Methylguanosine is often found in the cap structure of eukaryotic mRNAs, contributing to mRNA stability and protection from degradation. Its presence can also enhance the efficiency of translation by facilitating the recognition of mRNA by ribosomes. The compound is soluble in water and exhibits typical nucleoside properties, including the ability to form hydrogen bonds and participate in base pairing. Due to its biological significance, 3′-O-Methylguanosine is of interest in research related to gene regulation, RNA processing, and the development of therapeutic agents targeting RNA.
Formula:C11H15N5O5
InChI:InChI=1S/C11H15N5O5/c1-20-7-4(2-17)21-10(6(7)18)16-3-13-5-8(16)14-11(12)15-9(5)19/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=UYARPHAXAJAZLU-KQYNXXCUSA-N
SMILES:O=C1N=C(N)NC2=C1N=CN2C3OC(CO)C(OC)C3O
- Synonyms:
- 3'-O-Methylguanosine
- 3-Omg
- Nsc 106541
- Guanosine, 3'-O-methyl-
- 2-amino-9-(3-O-methylpentofuranosyl)-3,9-dihydro-6H-purin-6-one
- 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-3H-purin-6-one
![2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-3H-purin-6-one](https://static.cymitquimica.com/products/IN/thumb/DA008SO6.jpg)
![2-AMINO-9-[(2R,3R,4S,5R)-3-HYDROXY-5-(HYDROXYMETHYL)-4-METHOXYOXOLAN-2-YL]-3H-PURIN-6-ONE](https://static.cymitquimica.com/products/10/thumb/F513025.jpg)
