
CAS 10302-15-5
:1-(Phenylsulfonyl)aziridine
Description:
1-(Phenylsulfonyl)aziridine is a chemical compound characterized by its aziridine ring, which is a three-membered cyclic amine. The presence of a phenylsulfonyl group enhances its reactivity and solubility in various organic solvents. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its role in organic synthesis, particularly in the formation of more complex molecules through nucleophilic substitution reactions. The sulfonyl group contributes to the electrophilic nature of the aziridine, making it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 1-(Phenylsulfonyl)aziridine may exhibit unique properties such as stability under certain conditions, but it can also be sensitive to moisture and light, necessitating careful handling and storage. As with many aziridines, it may pose health risks, including irritation to the skin and eyes, and should be handled with appropriate safety precautions in a laboratory setting.
Formula:C8H9NO2S
InChI:InChI=1S/C8H9NO2S/c10-12(11,9-6-7-9)8-4-2-1-3-5-8/h1-5H,6-7H2
InChI key:InChIKey=AXWKGBIMVDATLR-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CC1)C2=CC=CC=C2
Synonyms:- 1-(Benzenesulfonyl)aziridine
- Aziridine, 1-(phenylsulfonyl)-
- N-(Phenylsulfonyl)aziridine
- 1-(Phenylsulfonyl)aziridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.