
CAS 1030269-33-0
:3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole
Description:
3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole is a synthetic organic compound characterized by its unique pyrazole core and multiple perfluorinated alkyl chains. The presence of the tridecafluorohexyl groups imparts significant hydrophobicity and lipophobicity, making the compound highly resistant to water and oil, which can enhance its utility in various applications, including surface coatings and as a surfactant. The fluorinated alkyl chains contribute to its thermal and chemical stability, while the pyrazole moiety may provide specific reactivity or biological activity. This compound is likely to exhibit low volatility and high stability under a range of environmental conditions. Its unique structure may also influence its interactions with biological systems, potentially leading to applications in pharmaceuticals or agrochemicals. However, the environmental impact and toxicity of perfluorinated compounds are important considerations, as they can persist in the environment and bioaccumulate. Overall, 3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole represents a complex and specialized chemical with potential industrial and research applications.
Formula:C15H2F26N2
InChI:InChI=1S/C15H2F26N2/c16-4(17,6(20,21)8(24,25)10(28,29)12(32,33)14(36,37)38)2-1-3(43-42-2)5(18,19)7(22,23)9(26,27)11(30,31)13(34,35)15(39,40)41/h1H,(H,42,43)
InChI key:InChIKey=MWEVZBCRQDLSLM-UHFFFAOYSA-N
SMILES:C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(F)(F)C=1C=C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)NN1)(F)F)(F)F
Synonyms:- 3,5-Bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrazole
- 1H-Pyrazole, 3,5-bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-Bis(perfluorohexyl)pyrazole
CAS:<p>3,5-Bis(perfluorohexyl)pyrazole</p>Molecular weight:704.14826g/mol

