CAS 1030269-34-1

3,5-Bis(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole

Description:

3,5-Bis(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole is a synthetic organic compound characterized by its unique pyrazole structure, which features two heptafluoropropyl substituents at the 3 and 5 positions. The presence of multiple fluorine atoms contributes to its high hydrophobicity and thermal stability, making it useful in various applications, including as a potential intermediate in the synthesis of fluorinated materials. The compound is likely to exhibit low volatility and high chemical resistance due to the strong C-F bonds. Its molecular structure suggests potential applications in fields such as agrochemicals, pharmaceuticals, and materials science, particularly in the development of fluorinated polymers or coatings. Additionally, the compound's properties may include a high degree of lipophilicity, which can influence its behavior in biological systems. Safety data and handling precautions should be considered, as fluorinated compounds can pose environmental and health risks. Overall, 3,5-Bis(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole represents a specialized class of fluorinated organic compounds with distinct characteristics.

Formula: C₉H₂F₁₄N₂

InChI: InChI=1S/C9H2F14N2/c10-4(11,6(14,15)8(18,19)20)2-1-3(25-24-2)5(12,13)7(16,17)9(21,22)23/h1H,(H,24,25)

InChI key: InChIKey=BRSNCGJMPSXZCL-UHFFFAOYSA-N

SMILES: C(C(F)(F)C=1C=C(C(C(C(F)(F)F)(F)F)(F)F)NN1)(C(F)(F)F)(F)F

Synonyms:

• 1H-Pyrazole, 3,5-bis(1,1,2,2,3,3,3-heptafluoropropyl)-
• 3,5-Bis(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole

3,5-Bis(heptafluoropropyl)pyrazole

CAS: 1030269-34-1

3,5-Bis(heptafluoropropyl)pyrazole

Molecular weight: 404.10322g/mol

Ref: 54-PC107239