CAS 103028-32-6

6-Bromo-8-methoxyquinoline

Description:

6-Bromo-8-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methoxy group at the 8-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The bromine substituent can enhance reactivity, making it a useful intermediate in various synthetic pathways. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its biological activity. As with many quinoline derivatives, 6-bromo-8-methoxyquinoline may exhibit antimicrobial or antitumor properties, making it a subject of interest in drug discovery and development.

Formula: C₁₀H₈BrNO

InChI: InChI=1S/C10H8BrNO/c1-13-9-6-8(11)5-7-3-2-4-12-10(7)9/h2-6H,1H3

InChI key: InChIKey=JXXVYYHNERBSBL-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C(Br)C1)C=CC=N2

Synonyms:

• Quinoline, 6-bromo-8-methoxy-
• 6-Bromo-8-methoxyquinoline

6-Bromo-8-methoxyquinoline

CAS: 103028-32-6

Formula: C₁₀H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 238.0806

Ref: IN-DA0095V0

6-Bromo-8-methoxyquinoline

CAS: 103028-32-6

6-Bromo-8-methoxyquinoline

Purity: 98%

Molecular weight: 238.08g/mol

Ref: 54-OR92531

6-BROMO-8-METHOXYQUINOLINE

CAS: 103028-32-6

Formula: C₁₀H₈BrNO

Purity: 98%

Molecular weight: 238.084

Ref: 10-F535173

6-Bromo-8-methoxyquinoline

CAS: 103028-32-6

6-Bromo-8-methoxyquinoline is a quinoline that has shown anticancer activity. The anticancer effect of this compound is due to its ability to inhibit the synthesis of DNA, RNA, and protein in tumor cells. This drug also has a cytotoxic effect on lymphocytes. 6-Bromo-8-methoxyquinoline is a derivative of methoxyquinoline, which was used as an antiparasitic agent for the treatment of schistosomiasis.

Formula: C₁₀H₈BrNO

Purity: Min. 95%

Molecular weight: 238.08 g/mol

Ref: 3D-DEA02832