CAS 103028-82-6

7-Isoquinolinol, 1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1)

Description:

7-Isoquinolinol, 1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This specific derivative is a tetrahydroisoquinoline, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a hydroxyl group (-OH) at the 7-position and a methyl group (-CH3) at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as neuroactivity or other pharmacological effects, making it of interest in medicinal chemistry. Its CAS number, 103028-82-6, allows for precise identification in chemical databases. Overall, this compound's structural features and solubility profile suggest potential applications in drug development and synthesis.

Formula: C₁₀H₁₃NO·ClH

InChI: InChI=1S/C10H13NO.ClH/c1-11-5-4-8-2-3-10(12)6-9(8)7-11;/h2-3,6,12H,4-5,7H2,1H3;1H

InChI key: InChIKey=TXVANCRWNIRXGO-UHFFFAOYSA-N

SMILES: OC=1C=C2C(CCN(C)C2)=CC1.Cl

Synonyms:

• 2-Methyl-1,2,3,4-tetrahydroisoquinolin-7-ol hydrochloride
• 7-Isoquinolinol, 1,2,3,4-tetrahydro-2-methyl-, hydrochloride (1:1)
• 7-Isoquinolinol, 1,2,3,4-tetrahydro-2-methyl-, hydrochloride