CAS 1030288-90-4

Dimethyl B-(2-methoxy-5-pyrimidinyl)boronate

Description:

Dimethyl B-(2-methoxy-5-pyrimidinyl)boronate is an organoboron compound characterized by the presence of a boronate ester functional group and a pyrimidine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as dichloromethane and ethyl acetate, but generally insoluble in water due to its hydrophobic nature. The presence of the methoxy group enhances its reactivity and solubility in organic media, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and organic synthesis. Dimethyl B-(2-methoxy-5-pyrimidinyl)boronate can participate in cross-coupling reactions, serving as a valuable intermediate in the synthesis of biologically active compounds. Additionally, it may exhibit specific biological activities, although detailed studies on its pharmacological properties may be limited. Proper handling and storage are essential, as with many organoboron compounds, to ensure safety and stability.

Formula: C₇H₁₁BN₂O₃

InChI: InChI=1S/C7H11BN2O3/c1-11-7-9-4-6(5-10-7)8(12-2)13-3/h4-5H,1-3H3

InChI key: InChIKey=AZBFKARDPKAQNK-UHFFFAOYSA-N

SMILES: B(OC)(OC)C=1C=NC(OC)=NC1

Synonyms:

• Boronic acid, B-(2-methoxy-5-pyrimidinyl)-, dimethyl ester
• Dimethyl B-(2-methoxy-5-pyrimidinyl)boronate

2-Methoxypyrimidine-5-boronic acid, dimethyl ester

CAS: 1030288-90-4

2-Methoxypyrimidine-5-boronic acid, dimethyl ester

Purity: ≥95%

Molecular weight: 181.98g/mol

Ref: 54-OR9898