CAS 103029-76-1

6-Nitro-3-quinolinol

Description:

6-Nitro-3-quinolinol is an organic compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound is distinguished by the presence of a nitro group (-NO2) at the 6-position and a hydroxyl group (-OH) at the 3-position of the quinoline ring. These functional groups contribute to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. The nitro group can participate in electrophilic substitution reactions, while the hydroxyl group can engage in hydrogen bonding, influencing the compound's solubility and interaction with biological systems. 6-Nitro-3-quinolinol may exhibit biological activity, making it of interest for research into pharmaceuticals or agrochemicals. Its properties, such as melting point, solubility, and spectral characteristics, are essential for understanding its behavior in different environments and applications. As with many nitro-containing compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₉H₆N₂O₃

InChI: InChI=1S/C9H6N2O3/c12-8-4-6-3-7(11(13)14)1-2-9(6)10-5-8/h1-5,12H

InChI key: InChIKey=MMFMFMFWFURFKZ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC2=C(C=C1)N=CC(O)=C2

Synonyms:

• 6-Nitro-3-quinolinol
• 3-Quinolinol, 6-nitro-