CAS 103029-77-2

7-Hydroxy-6-quinoxalinecarboxylic acid

Description:

7-Hydroxy-6-quinoxalinecarboxylic acid, identified by its CAS number 103029-77-2, is a heterocyclic organic compound featuring a quinoxaline structure. This compound is characterized by the presence of a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the quinoxaline ring, which contributes to its potential biological activity. The hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents, while the carboxylic acid group can dissociate in aqueous solutions, influencing its reactivity and interaction with other molecules. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. Additionally, its structural features allow for potential applications in the development of novel therapeutic agents. The stability of 7-Hydroxy-6-quinoxalinecarboxylic acid under various conditions, as well as its reactivity with other chemical species, can be influenced by factors such as pH and temperature, which are important considerations in its practical applications.

Formula: C₉H₆N₂O₃

InChI: InChI=1S/C9H6N2O3/c12-8-4-7-6(10-1-2-11-7)3-5(8)9(13)14/h1-4,12H,(H,13,14)

InChI key: InChIKey=IRTGHOZPSJSVDS-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC2=C(C=C1O)N=CC=N2

Synonyms:

• 7-Hydroxy-6-quinoxalinecarboxylic acid
• 6-Quinoxalinecarboxylic acid, 7-hydroxy-