CAS 10303-88-5

methyl (2S)-2,3-dihydroxypropanoate

Description:

Methyl (2S)-2,3-dihydroxypropanoate, with the CAS number 10303-88-5, is an organic compound characterized by its ester functional group and the presence of two hydroxyl (-OH) groups on a three-carbon backbone. This compound is a chiral molecule, with the (2S) designation indicating the specific stereochemistry at the second carbon atom. It is typically a colorless to pale yellow liquid with a sweet, fruity odor, which is common among many esters. The presence of hydroxyl groups contributes to its solubility in water and polar solvents, while the ester group influences its reactivity and potential applications in organic synthesis. Methyl (2S)-2,3-dihydroxypropanoate can be involved in various chemical reactions, including esterification and oxidation, making it a valuable intermediate in the synthesis of pharmaceuticals and other organic compounds. Its properties, such as boiling point and density, can vary based on environmental conditions and purity. Overall, this compound is of interest in both academic research and industrial applications due to its functional groups and stereochemistry.

Formula: C₄H₈O₄

InChI: InChI=1/C4H8O4/c1-8-4(7)3(6)2-5/h3,5-6H,2H2,1H3/t3-/m0/s1

SMILES: COC(=O)[C@H](CO)O

Synonyms:

• methyl (S)-glycerate
• propanoic acid, 2,3-dihydroxy-, methyl ester, (2S)-
• Methyl (2S)-2,3-dihydroxypropanoate

(S)-Methyl 2,3-dihydroxypropanoate

CAS: 10303-88-5

Formula: C₄H₈O₄

Purity: 96%

Color and Shape: Liquid

Molecular weight: 120.1039

Ref: IN-DA007IAU

(S)-Methyl 2,3-dihydroxypropanoate

CAS: 10303-88-5

(S)-Methyl 2,3-dihydroxypropanoate

Purity: 99%

Molecular weight: 120.10g/mol

Ref: 54-OR74580

(S)-Methyl 2,3-dihydroxypropanoate

CAS: 10303-88-5

Formula: C₄H₈O₄

Purity: 95%

Color and Shape: Liquid

Molecular weight: 120.104

Ref: 10-F078180