CymitQuimica logo

CAS 103030-08-6

:

3-METHYL-6-NITROCOUMARIN

Description:
3-Methyl-6-nitrocoumarin is a synthetic organic compound belonging to the coumarin family, characterized by its aromatic structure and the presence of both a methyl and a nitro group. This compound typically exhibits a yellow to orange crystalline appearance and is known for its fluorescent properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. The nitro group contributes to its reactivity and potential applications in organic synthesis. 3-Methyl-6-nitrocoumarin is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. Its fluorescence can be influenced by the pH of the environment, which is a valuable property for monitoring changes in biological systems. Additionally, due to the presence of the nitro group, it may exhibit some degree of toxicity and should be handled with care in laboratory settings. Overall, this compound is of interest in research fields such as medicinal chemistry and materials science due to its unique chemical properties and potential applications.
Formula:C10H7NO4
InChI:InChI=1/C10H7NO4/c1-6-4-7-5-8(11(13)14)2-3-9(7)15-10(6)12/h2-5H,1H3
SMILES:Cc1cc2cc(ccc2oc1=O)N(=O)=O
Synonyms:
  • 2H-1-Benzopyran-2-one, 3-methyl-6-nitro-
  • 3-Methyl-6-nitro-2H-chromen-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.