CymitQuimica logo

CAS 1030385-99-9

:

1-[(2-Chloro-6-fluorophenyl)methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine

Description:
1-[(2-Chloro-6-fluorophenyl)methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring, a pyrazole moiety, and various halogenated aromatic groups. The presence of chlorine and fluorine atoms contributes to its potential biological activity and lipophilicity, influencing its interactions with biological targets. This compound is likely to exhibit significant pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential applications in areas such as anti-inflammatory or analgesic drug development. The CAS number 1030385-99-9 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. As with many synthetic organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances. Safety and handling precautions are essential when working with this compound due to its complex nature and potential biological effects.
Formula:C22H20ClF4N3
InChI:InChI=1S/C22H20ClF4N3/c23-18-5-2-6-19(24)17(18)13-30-9-7-14(8-10-30)20-12-21(29-28-20)15-3-1-4-16(11-15)22(25,26)27/h1-6,11-12,14H,7-10,13H2,(H,28,29)
InChI key:InChIKey=DKMGAGHFLHJLIK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C2=CC(=NN2)C3CCN(CC4=C(Cl)C=CC=C4F)CC3)C=CC1
Synonyms:
  • Piperidine, 1-[(2-chloro-6-fluorophenyl)methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]-
  • 1-[(2-Chloro-6-fluorophenyl)methyl]-4-[5-[3-(trifluoromethyl)phenyl]-1H-pyrazol-3-yl]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.