CAS 103039-88-9

4-Methylisonipecotic acid ethyl ester

Description:

4-Methylisonipecotic acid ethyl ester, with the CAS number 103039-88-9, is a chemical compound that belongs to the class of isonipecotic acids, which are derivatives of piperidine. This compound features a methyl group at the 4-position of the isonipecotic acid structure, which contributes to its unique properties. It is typically characterized by its molecular formula, which includes carbon, hydrogen, and nitrogen atoms, reflecting its organic nature. The ethyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding acid. This compound is of interest in medicinal chemistry and pharmacology due to its potential biological activities, including effects on the central nervous system. Its solubility characteristics may vary, but it is generally soluble in organic solvents. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 4-Methylisonipecotic acid ethyl ester represents a significant compound for research and development in various chemical and pharmaceutical applications.

Formula: C₉H₁₇NO₂

InChI: InChI=1/C9H17NO2/c1-3-12-8(11)9(2)4-6-10-7-5-9/h10H,3-7H2,1-2H3

SMILES: CCOC(=O)C1(C)CCNCC1

Synonyms:

• 4-Methylpiperidin-4-carboxylic acid ethyl ester
• Ethyl 4-methylpiperidine-4-carboxylate

Ethyl 4-methylpiperidine-4-carboxylate

CAS: 103039-88-9

Formula: C₉H₁₇NO₂

Color and Shape: Liquid

Molecular weight: 171.2368

Ref: IN-DA007Y6S

Ethyl 4-methylpiperidine-4-carboxylate

CAS: 103039-88-9

Formula: C₉H₁₇NO₂

Purity: 95.0%

Molecular weight: 171.24

Ref: 10-F078616