CAS 10304-09-3

methoxy(oxo)acetic acid

Description:

Methoxy(oxo)acetic acid, with the CAS number 10304-09-3, is an organic compound characterized by the presence of both a methoxy group (-OCH3) and a carboxylic acid functional group (-COOH) in its structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its polar nature, which enhances its solubility in water and other polar solvents. The methoxy group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and acylation. Methoxy(oxo)acetic acid may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications. Additionally, it can serve as an intermediate in organic synthesis, particularly in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₃H₄O₄

InChI: InChI=1/C3H4O4/c1-7-3(6)2(4)5/h1H3,(H,4,5)

SMILES: COC(=O)C(=O)O

Potassium methyl oxalate

CAS: 10304-09-3

Formula: C₃H₃KO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1518

Ref: IN-DA00H9WZ

Methyl potassium oxalate

CAS: 10304-09-3

Methyl potassium oxalate

Formula: C₃H₃O₄·K

Purity: 98%

Color and Shape: white solid

Molecular weight: 142.15g/mol

Ref: 54-OR303344

Tiotropium Bromide Impurity 8 Potassium Salt

CAS: 10304-09-3

Formula: C₃H₃O₄·K

Color and Shape: White To Off-White Solid

Molecular weight: 103.05 39.10

Ref: 4Z-T-3224

Potassium 2-methoxy-2-oxoacetate

CAS: 10304-09-3

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 142.1510009765625

Ref: 10-F540355