CymitQuimica logo

CAS 103040-54-6

:

3-chloro-N-(3-chlorobenzyl)propanamide

Description:
3-Chloro-N-(3-chlorobenzyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of chlorine atoms in both the propanamide and the benzyl moiety contributes to its chemical reactivity and potential biological activity. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The chlorinated benzyl group may enhance its lipophilicity, influencing its interaction with biological membranes. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where halogenated compounds often exhibit unique properties such as increased potency or selectivity. Additionally, the presence of the amide group may facilitate hydrogen bonding, affecting its solubility and reactivity. Safety data should be consulted for handling and exposure, as halogenated compounds can pose environmental and health risks. Overall, 3-chloro-N-(3-chlorobenzyl)propanamide is a notable compound in organic synthesis and medicinal chemistry.
Formula:C10H11Cl2NO
InChI:InChI=1/C10H11Cl2NO/c11-5-4-10(14)13-7-8-2-1-3-9(12)6-8/h1-3,6H,4-5,7H2,(H,13,14)
SMILES:c1cc(cc(c1)Cl)CN=C(CCCl)O
Synonyms:
  • propanamide, 3-chloro-N-[(3-chlorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.