CymitQuimica logo

CAS 1030419-74-9

:

7-Amino-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile

Description:
7-Amino-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features an amino group and a methyl group, which contribute to its reactivity and potential biological activity. The presence of the carbonitrile functional group enhances its polarity and may influence its solubility in various solvents. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the fields of medicinal chemistry and drug development, due to their ability to interact with biological targets. The structural complexity of 7-Amino-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile suggests potential applications in the synthesis of novel therapeutic agents. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C7H6N6
InChI:InChI=1S/C7H6N6/c1-4-5(2-8)6(9)13-7(12-4)10-3-11-13/h3H,9H2,1H3
InChI key:InChIKey=FSUYSNUIRGHCEA-UHFFFAOYSA-N
SMILES:NC=1N2C(N=C(C)C1C#N)=NC=N2
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyrimidine-6-carbonitrile, 7-amino-5-methyl-
  • 7-Amino-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.