
CAS 10305-43-8
:N-Butylsulfamoyl chloride
Description:
N-Butylsulfamoyl chloride, with the CAS number 10305-43-8, is an organic compound characterized by the presence of a sulfonamide functional group attached to a butyl chain. It typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly as a chlorinating agent. The compound features a sulfonamide moiety, which contributes to its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. N-Butylsulfamoyl chloride is soluble in organic solvents but may react with water, releasing hydrochloric acid and forming the corresponding sulfonamide. Due to its reactive nature, it should be handled with care, as it can cause irritation to the skin, eyes, and respiratory system. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound. Its utility in organic synthesis makes it a valuable reagent in the development of sulfonamide-based drugs and other chemical entities.
Formula:C4H10ClNO2S
InChI:InChI=1S/C4H10ClNO2S/c1-2-3-4-6-9(5,7)8/h6H,2-4H2,1H3
InChI key:InChIKey=CLYYLYYRTGRJTL-UHFFFAOYSA-N
SMILES:N(S(Cl)(=O)=O)CCCC
Synonyms:- Butylaminosulfonyl chloride
- Butylsulfamoyl chloride
- Sulfamoyl chloride, N-butyl-
- N-Butylsulfamoyl chloride
- Sulfamoyl chloride, butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.