CAS 103051-26-9
:B 746
Description:
B 746, identified by its CAS number 103051-26-9, is a chemical compound that belongs to a class of substances known for their specific applications in various fields, including pharmaceuticals and materials science. While detailed characteristics such as its molecular structure, physical properties, and reactivity may vary, compounds like B 746 typically exhibit unique functional groups that influence their behavior in chemical reactions. They may possess properties such as solubility in certain solvents, stability under various conditions, and specific melting or boiling points. Additionally, B 746 may have applications in synthesis processes or as an intermediate in the production of more complex molecules. Safety data sheets would provide essential information regarding its handling, toxicity, and environmental impact. For precise applications and characteristics, consulting specialized literature or databases is recommended, as they can provide comprehensive insights into the compound's behavior and uses in industrial or laboratory settings.
Formula:C26H20Cl2N4
InChI:InChI=1/C26H20Cl2N4/c1-2-29-22-16-26-24(15-23(22)30-19-11-7-17(27)8-12-19)31-21-5-3-4-6-25(21)32(26)20-13-9-18(28)10-14-20/h3-16,30H,2H2,1H3/b29-22+
Synonyms:- 3-p-Chloroanilino-10-(p-chlorophenyl)-2-(ethylimino)-2,10-dihydrophenazine
- B746
- N,5-Bis(4-chlorophenyl)-3-(ethylimino)-3,5-dihydro-2-phenazinamine
- Phenazine, 3-p-chloroanilino-10-(p-chlorophenyl)-2-(ethylimino)-2,10-dihydro-
- (3E)-N,5-bis(4-chlorophenyl)-3-(ethylimino)-3,5-dihydrophenazin-2-amine
- B-746
- Clofazimine Impurity 3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
B 746
CAS:B 746 is an antibacterial for leprosy, Mycobacterium avium, and drug-resistant tuberculosis.Formula:C26H20Cl2N4Color and Shape:SolidMolecular weight:459.37

