
CAS 103057-15-4
:4-[(2-Bromoethyl)thio]pyridine
Description:
4-[(2-Bromoethyl)thio]pyridine is an organic compound characterized by the presence of a pyridine ring substituted with a thioether group linked to a bromoethyl moiety. This compound features a five-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The bromoethyl group introduces a halogen, making it a suitable candidate for nucleophilic substitution reactions. The thioether linkage enhances its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in synthesizing more complex molecules or as an intermediate in various chemical reactions. Additionally, the presence of both a halogen and a sulfur atom can influence its interaction with other chemical species, potentially leading to diverse reactivity patterns. Overall, 4-[(2-Bromoethyl)thio]pyridine is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C7H8BrNS
InChI:InChI=1S/C7H8BrNS/c8-3-6-10-7-1-4-9-5-2-7/h1-2,4-5H,3,6H2
InChI key:InChIKey=ZUXNSAWDSDMHQO-UHFFFAOYSA-N
SMILES:S(CCBr)C=1C=CN=CC1
Synonyms:- 4-[(2-Bromoethyl)thio]pyridine
- Pyridine, 4-[(2-bromoethyl)thio]-
- 4-(2-Bromoethyl)thiopyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.