CAS 103058-87-3

5-bromo-2-methoxy-pyridine-3-carbaldehyde

Description:

5-Bromo-2-methoxy-pyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methoxy group at the 2-position contributes to its unique reactivity and properties. The aldehyde functional group at the 3-position is significant for its potential applications in organic synthesis, particularly in the formation of various derivatives through nucleophilic addition reactions. This compound is typically a pale yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure allows for various interactions, making it useful in medicinal chemistry and as an intermediate in the synthesis of more complex molecules. Additionally, the presence of both electron-withdrawing (bromine) and electron-donating (methoxy) groups influences its electronic properties, which can affect its reactivity and interaction with biological targets. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.

Formula: C₇H₆BrNO₂

InChI: InChI=1/C7H6BrNO2/c1-11-7-5(4-10)2-6(8)3-9-7/h2-4H,1H3

SMILES: COc1c(cc(cn1)Br)C=O

Synonyms:

• 5-Bromo-2-Methoxypyridine-3-Carboxaldehyde
• 5-bromo-2-methoxynicotinaldehyde

5-BROMO-2-METHOXYPYRIDINE-3-CARBALDEHYDE

CAS: 103058-87-3

Formula: C₇H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.0320

Ref: IN-DA00382J

5-Bromo-2-methoxypyridine-3-carbaldehyde

CAS: 103058-87-3

5-Bromo-2-methoxypyridine-3-carbaldehyde

Purity: 99%

Molecular weight: 216.03g/mol

Ref: 54-OR90290

5-Bromo-2-methoxynicotinaldehyde

CAS: 103058-87-3

5-Bromo-2-methoxynicotinaldehyde

Purity: 99%

Molecular weight: 216.03g/mol

Ref: 54-OR60090

5-Bromo-2-methoxynicotinaldehyde

CAS: 103058-87-3

Formula: C₇H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 216.034

Ref: 10-F046219