CAS 103061-56-9

1-[(2-Bromoethoxy)methyl]-3-methylbenzene

Description:

1-[(2-Bromoethoxy)methyl]-3-methylbenzene, also known by its CAS number 103061-56-9, is an organic compound characterized by its aromatic structure, which includes a methyl group and a bromoethoxy substituent. This compound features a benzene ring with a methyl group at the meta position and an ethoxy group that is further substituted with a bromine atom. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ethoxy group contributes to the compound's solubility in organic solvents, while the aromatic nature of the benzene ring provides stability and influences its physical properties, such as boiling and melting points. Additionally, the compound may exhibit specific interactions with biological systems, which could be relevant in medicinal chemistry or material science applications. Overall, its unique structure and functional groups make it a compound of interest in synthetic organic chemistry and related fields.

Formula: C₁₀H₁₃BrO

InChI: InChI=1S/C10H13BrO/c1-9-3-2-4-10(7-9)8-12-6-5-11/h2-4,7H,5-6,8H2,1H3

InChI key: InChIKey=FORYOPLLZXSTCT-UHFFFAOYSA-N

SMILES: C(OCCBr)C1=CC(C)=CC=C1

Synonyms:

• 1-[(2-Bromoethoxy)methyl]-3-methylbenzene
• Benzene, 1-[(2-bromoethoxy)methyl]-3-methyl-