CAS 1030613-09-2
:5-Bromo-1,3,4-thiadiazole-2-carboxamide
Description:
5-Bromo-1,3,4-thiadiazole-2-carboxamide is a heterocyclic compound characterized by the presence of a thiadiazole ring, which incorporates sulfur and nitrogen atoms. The compound features a bromine substituent at the 5-position and a carboxamide functional group at the 2-position, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxamide group. The bromine atom enhances the compound's electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. This compound may also possess antimicrobial or antifungal properties, as many thiadiazole derivatives are known for their biological activities. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C3H2BrN3OS
InChI:InChI=1S/C3H2BrN3OS/c4-3-7-6-2(9-3)1(5)8/h(H2,5,8)
InChI key:InChIKey=VSXVUEUQCVYVPM-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1SC(Br)=NN1
Synonyms:- 1,3,4-Thiadiazole-2-carboxamide, 5-bromo-
- 5-Bromo-1,3,4-thiadiazole-2-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.