CAS 103065-89-0

2-Azabicyclo[2.2.1]heptan-3-one, 2-(phenylmethyl)-, (1S)-

Description:

2-Azabicyclo[2.2.1]heptan-3-one, 2-(phenylmethyl)-, (1S)-, commonly referred to as a bicyclic compound, features a unique bicyclic structure that includes a nitrogen atom within its ring system. This compound is characterized by its azabicyclic framework, which contributes to its potential biological activity. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its interaction with biological targets. As a ketone, it possesses a carbonyl functional group, which can participate in various chemical reactions, including nucleophilic additions. The stereochemistry indicated by (1S) suggests a specific three-dimensional arrangement of atoms, which can significantly affect the compound's reactivity and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of novel therapeutic agents. However, detailed studies on its pharmacological properties and mechanisms of action would be necessary to fully understand its potential applications.

Formula: C₁₃H₁₅NO

InChI: InChI=1S/C13H15NO/c15-13-11-6-7-12(8-11)14(13)9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12+/m1/s1

InChI key: InChIKey=PFNDBUGYKATODF-NEPJUHHUSA-N

SMILES: C(N1[C@@]2(C[C@](C1=O)(CC2)[H])[H])C3=CC=CC=C3

Synonyms:

• 2-Azabicyclo[2.2.1]heptan-3-one, 2-(phenylmethyl)-, (1S)-