CAS 103068-82-2
:compound FP 2
Description:
Compound FP 2, identified by its CAS number 103068-82-2, is a chemical substance that falls under the category of fluorinated compounds. While specific details about its physical and chemical properties may vary, fluorinated compounds generally exhibit unique characteristics such as high thermal stability, low reactivity, and resistance to degradation. These properties make them useful in various applications, including pharmaceuticals, agrochemicals, and specialty materials. Additionally, fluorinated compounds often possess low surface tension and high lipophilicity, which can influence their behavior in biological systems and environmental contexts. The presence of fluorine atoms typically enhances the compound's hydrophobicity and can affect its solubility in different solvents. For precise applications, safety data, and regulatory information, consulting specialized databases or scientific literature is recommended, as these resources provide comprehensive insights into the compound's behavior and potential uses.
Formula:C18H24ClFN4O2
InChI:InChI=1/C18H23FN4O2.ClH/c1-5-23(6-2)11-15(24)20-18-16(12(3)21-22(18)4)17(25)13-9-7-8-10-14(13)19;/h7-10H,5-6,11H2,1-4H3,(H,20,24);1H
SMILES:CCN(CC)CC(=Nc1c(c(C)nn1C)C(=O)c1ccccc1F)O.Cl
Synonyms:- 2-(Diethylamino)-N-(4-(2-fluorobenzoyl)-1,3-dimethyl-1-H-pyrazol-5-yl)acetamide hcl
- Fp-2
- Acetamide, 2-(diethylamino)-N-(4-(2-fluorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl)-, monohydrochloride
- N,N-diethyl-2-{[4-(2-fluorobenzoyl)-1,3-dimethyl-1H-pyrazol-5-yl]amino}-2-oxoethanaminium chloride
- Compound FP 2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.