CAS 10307-60-5
:D-methyl 2-methylbutyrate
Description:
D-methyl 2-methylbutyrate is an organic compound classified as an ester, specifically a methyl ester of 2-methylbutanoic acid. It is characterized by its fruity odor, which makes it useful in flavoring and fragrance applications. The molecular formula of D-methyl 2-methylbutyrate reflects its structure, containing a branched alkyl chain that contributes to its unique properties. This compound is typically a colorless liquid at room temperature and is soluble in organic solvents, while having limited solubility in water due to its hydrophobic nature. D-methyl 2-methylbutyrate is often utilized in the food industry for flavor enhancement and in the production of various chemical intermediates. Additionally, it may be involved in synthetic organic chemistry as a building block for more complex molecules. Safety data indicates that, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Proper storage and handling protocols are essential to ensure safety and maintain the integrity of the substance.
Formula:C6H12O2
InChI:InChI=1/C6H12O2/c1-4-5(2)6(7)8-3/h5H,4H2,1-3H3
SMILES:CCC(C)C(=O)OC
Synonyms:- (S)-methyl 2-methylbutyrate
- D-Methyl 2-Methyl Butyrate
- Methyl 2-Methylbutanoate
- Methyl (2S)-2-Methylbutanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2S)-2-Methyl-butanoic Acid Methyl Ester
CAS:Controlled ProductFormula:C6H12O2Color and Shape:NeatMolecular weight:116.158(2S)-2-Methyl-butanoic Acid Methyl Ester-d3
CAS:Controlled ProductFormula:C6D3H9O2Color and Shape:NeatMolecular weight:119.177
