
CAS 1030832-49-5
:3-(Bromomethyl)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
Description:
3-(Bromomethyl)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide is a complex organic compound characterized by the presence of a sulfonamide functional group, a bromomethyl substituent, and a boron-containing dioxaborolane moiety. The sulfonamide group contributes to its potential as a bioactive molecule, often enhancing solubility and reactivity. The bromomethyl group serves as a versatile site for further chemical modifications, making it useful in synthetic chemistry. The dioxaborolane structure is notable for its stability and ability to participate in various reactions, including cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. This compound may exhibit specific physical properties such as solubility in organic solvents and potential reactivity under certain conditions, which can be influenced by the steric and electronic effects of the substituents. Overall, its unique structural features suggest potential applications in medicinal chemistry and materials science, although specific reactivity and biological activity would require further investigation.
Formula:C15H23BBrNO4S
InChI:InChI=1S/C15H23BBrNO4S/c1-14(2)15(3,4)22-16(21-14)13-8-7-12(9-11(13)10-17)23(19,20)18(5)6/h7-9H,10H2,1-6H3
InChI key:InChIKey=HDVJMQPNMPPUEV-UHFFFAOYSA-N
SMILES:C(Br)C1=C(B2OC(C)(C)C(C)(C)O2)C=CC(S(N(C)C)(=O)=O)=C1
Synonyms:- 3-(Bromomethyl)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide
- Benzenesulfonamide, 3-(bromomethyl)-N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.