CAS 1030879-74-3

5,6,7,8-Tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinoline-5-carboxylic acid

Description:

5,6,7,8-Tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinoline-5-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which includes a dioxole and isoquinoline moiety. This compound features a tetrahydroisoquinoline framework, indicating that it has undergone hydrogenation, resulting in a saturated ring system. The presence of a methoxy group and a carboxylic acid functional group contributes to its potential reactivity and solubility in various solvents. The methyl group enhances its hydrophobic characteristics, while the dioxole ring may impart specific electronic properties. This compound is of interest in medicinal chemistry due to its structural features, which may influence biological activity. Its CAS number, 1030879-74-3, allows for precise identification in chemical databases. Overall, the compound's unique structural attributes suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic synthesis. Further studies would be necessary to explore its specific properties, reactivity, and potential uses in various chemical contexts.

Formula: C₁₃H₁₅NO₅

InChI: InChI=1S/C13H15NO5/c1-14-4-3-7-5-8-11(19-6-18-8)12(17-2)9(7)10(14)13(15)16/h5,10H,3-4,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=YVFCCVOPCOWOHQ-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C3C1OCO3)CCN(C)C2C(O)=O

Synonyms:

• 1,3-Dioxolo[4,5-g]isoquinoline-5-carboxylic acid, 5,6,7,8-tetrahydro-4-methoxy-6-methyl-
• 5,6,7,8-Tetrahydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinoline-5-carboxylic acid