CAS 10309-37-2: (+)-Bakuchiol
Description:(+)-Bakuchiol is a naturally occurring compound primarily derived from the seeds and leaves of the Psoralea corylifolia plant, commonly known as babchi. It is classified as a meroterpene and is recognized for its potential therapeutic properties, particularly in skincare and anti-aging formulations. The compound exhibits antioxidant, anti-inflammatory, and antimicrobial activities, making it a popular ingredient in cosmetic products. Chemically, (+)-Bakuchiol is characterized by its unique structure, which includes a bicyclic framework and multiple functional groups that contribute to its biological activity. It is often compared to retinol due to its similar effects on skin rejuvenation, but it is considered to be less irritating, making it suitable for sensitive skin types. Additionally, (+)-Bakuchiol has garnered attention in research for its potential role in modulating various cellular pathways, which may have implications for treating skin conditions and promoting overall skin health. Its safety profile and efficacy continue to be subjects of scientific investigation, highlighting its relevance in both traditional and modern medicine.
Formula:C18H24O
InChI:InChI=1S/C18H24O/c1-5-18(4,13-6-7-15(2)3)14-12-16-8-10-17(19)11-9-16/h5,7-12,14,19H,1,6,13H2,2-4H3/b14-12+/t18-/m1/s1
InChI key:InChIKey=LFYJSSARVMHQJB-QIXNEVBVSA-N
SMILES:OC1=CC=C(C=C1)C=CC(C=C)(C)CCC=C(C)C
- Synonyms:
- (S)-(+)-Bakuchiol
- 4-[(1E)-3-ethenyl-3,7-dimethylocta-1,6-dien-1-yl]phenol
- 4-[(1E)-7-methyl-3-vinyl-octa-1,6-dienyl]phenol
- 4-[(1E,3S)-3-Ethenyl-3,7-dimethyl-1,6-octadien-1-yl]phenol
- 4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dien-1-yl]phenol
- 7-Dimethyl-1,6-Octadienyl)-4-(3-Ethenyl-(S-(E))-Pheno
- Backuchiol
- Bactris Gasipaes Fruit Juice
- Bakuchiol
- Bakuchiol(Rg)
- See more synonyms
- Bakutrol
- Drupanol
- P-(3,7-Dimethyl-3-Vinylocta-Trans-1,6-Dimethyl) Phenol
- Phenol, 4-(3-Ethenyl-3,7-Dimethyl-1,6-Octadienyl)-, (E)-
- Phenol, 4-(3-ethenyl-3,7-dimethyl-1,6-octadienyl)-, [S-(E)]-
- Phenol, 4-[(1E,3S)-3-ethenyl-3,7-dimethyl-1,6-octadien-1-yl]-
- Phenol, 4-[(1E,3S)-3-ethenyl-3,7-dimethyl-1,6-octadienyl]-
- Phenol,4-(3-Ethenyl-3,7-Dimethyl-1,6-Octadienyl)
- Sytenol A
- Up 256
