CAS 103095-53-0

4-Methyl-1-phenyl-1H-pyrazol-5-amine

Description:

4-Methyl-1-phenyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a phenyl group attached to the pyrazole, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amino group (-NH2) at the 5-position of the pyrazole ring suggests potential for hydrogen bonding, influencing its reactivity and interaction with other molecules. This compound may be of interest in pharmaceutical research due to its potential biological activity, particularly in the development of drugs targeting various diseases. Its synthesis often involves multi-step organic reactions, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance.

Formula: C₁₀H₁₁N₃

InChI: InChI=1S/C10H11N3/c1-8-7-12-13(10(8)11)9-5-3-2-4-6-9/h2-7H,11H2,1H3

InChI key: InChIKey=MSLGMLSSZZGBPX-UHFFFAOYSA-N

SMILES: NC=1N(N=CC1C)C2=CC=CC=C2

Synonyms:

• 1H-Pyrazol-5-amine, 4-methyl-1-phenyl-
• Pyrazole, 5-amino-4-methyl-1-phenyl-
• 4-Methyl-1-phenyl-1H-pyrazol-5-amine

4-Methyl-1-phenyl-1H-pyrazol-5-amine

CAS: 103095-53-0

Versatile small molecule scaffold

Formula: C₁₀H₁₁N₃

Purity: Min. 95%

Molecular weight: 173.21 g/mol

Ref: 3D-DEA09553