CAS 1031-36-3

4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarboxamide

Description:

4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarboxamide, commonly known as a piperidine derivative, is characterized by its structural features that include a piperidine ring, an isopropylamino group, and a phenylmethyl substituent. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, which is common for many piperidine derivatives. It may possess biological activity, potentially acting as a pharmacological agent, although specific activity can vary based on its interactions with biological targets. The presence of the piperidine ring contributes to its basicity, allowing it to form salts with acids. Additionally, the compound's molecular structure suggests potential for hydrogen bonding, influencing its reactivity and interactions in various chemical environments. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry associated with piperidine derivatives in medicinal chemistry and organic synthesis.

Formula: C₁₆H₂₅N₃O

InChI: InChI=1S/C16H25N3O/c1-13(2)18-16(15(17)20)8-10-19(11-9-16)12-14-6-4-3-5-7-14/h3-7,13,18H,8-12H2,1-2H3,(H2,17,20)

InChI key: InChIKey=MSWWMXGLWBQMNG-UHFFFAOYSA-N

SMILES: N(C(C)C)C1(C(N)=O)CCN(CC2=CC=CC=C2)CC1

Synonyms:

• 1-Benzyl-4-(Propan-2-Ylamino)Piperidine-4-Carboxamide
• 1-Benzyl-4-[(propan-2-yl)amino]piperidine-4-carboxamide
• 1-Benzyl-4-isopropylamino-piperidine-4-carboxylic acid amide
• 4-Piperidinecarboxamide, 4-[(1-methylethyl)amino]-1-(phenylmethyl)-
• 4-[(1-Methylethyl)amino]-1-(phenylmethyl)-4-piperidinecarboxamide
• Isonipecotamide, 1-benzyl-4-(isopropylamino)-
• NSC 73389
• 1-Benzyl-4-(isopropylamino)piperidine-4-carboxamide