CymitQuimica logo

CAS 1031-67-0

:

2-MERCAPTO-3-(2-METHOXY-PHENYL)-3H-QUINAZOLIN-4-ONE

Description:
2-Mercapto-3-(2-methoxy-phenyl)-3H-quinazolin-4-one is a chemical compound characterized by its quinazolinone core structure, which features a mercapto (-SH) group and a methoxy-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the thiol group, which can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The methoxy group enhances the compound's lipophilicity, potentially influencing its biological activity and interactions. Additionally, quinazolinone derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The presence of the mercapto group may also contribute to its biological profile, as thiols are often involved in enzyme catalysis and redox biology. Overall, 2-Mercapto-3-(2-methoxy-phenyl)-3H-quinazolin-4-one is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C15H12N2O2S
InChI:InChI=1/C15H12N2O2S/c1-19-13-9-5-4-8-12(13)17-14(18)10-6-2-3-7-11(10)16-15(17)20/h2-9H,1H3,(H,16,20)
SMILES:COc1ccccc1n1c(=O)c2ccccc2nc1S
Synonyms:
  • 3-(2-Methoxyphenyl)-2-sulfanylquinazolin-4(3H)-one
  • 4(3H)-Quinazolinone, 2-mercapto-3-(2-methoxyphenyl)-
  • 3-(2-methoxyphenyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.